C10H13N3O4 — CID 43631077
2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]pentanoic acid (PubChem CID 43631077) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]pentanoic acid.
| Compound Name | 2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 43631077 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]pentanoic acid |
| SMILES | CCCC(NC(=O)c1c[nH]c(=O)cn1)C(=O)O |
| InChI | InChI=1S/C10H13N3O4/c1-2-3-6(10(16)17)13-9(15)7-4-12-8(14)5-11-7/h4-6H,2-3H2,1H3,(H,12,14)(H,13,15)(H,16,17) |
| InChIKey | ALTBRJJXNRFVHS-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |