C20H23N — CID 43632103
N-(3-phenylcyclobutyl)-5,6,7,8-tetrahydronaphthalen-1-amine (PubChem CID 43632103) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is N-(3-phenylcyclobutyl)-5,6,7,8-tetrahydronaphthalen-1-amine.
| Compound Name | N-(3-phenylcyclobutyl)-5,6,7,8-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 43632103 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-(3-phenylcyclobutyl)-5,6,7,8-tetrahydronaphthalen-1-amine |
| SMILES | c1ccc(C2CC(Nc3cccc4c3CCCC4)C2)cc1 |
| InChI | InChI=1S/C20H23N/c1-2-7-15(8-3-1)17-13-18(14-17)21-20-12-6-10-16-9-4-5-11-19(16)20/h1-3,6-8,10,12,17-18,21H,4-5,9,11,13-14H2 |
| InChIKey | ZFCULAYSSCZPQK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |