C19H20BrN — CID 43633283
N-[3-(3-bromophenyl)cyclobutyl]-2,3-dihydro-1H-inden-5-amine (PubChem CID 43633283) has the molecular formula C19H20BrN and a molecular weight of 342.28 g/mol. Its IUPAC name is N-[3-(3-bromophenyl)cyclobutyl]-2,3-dihydro-1H-inden-5-amine.
| Compound Name | N-[3-(3-bromophenyl)cyclobutyl]-2,3-dihydro-1H-inden-5-amine |
|---|---|
| PubChem CID | 43633283 |
| Molecular Formula | C19H20BrN |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-[3-(3-bromophenyl)cyclobutyl]-2,3-dihydro-1H-inden-5-amine |
| SMILES | Brc1cccc(C2CC(Nc3ccc4c(c3)CCC4)C2)c1 |
| InChI | InChI=1S/C19H20BrN/c20-17-6-2-5-14(9-17)16-11-19(12-16)21-18-8-7-13-3-1-4-15(13)10-18/h2,5-10,16,19,21H,1,3-4,11-12H2 |
| InChIKey | IOABENVIECYNCK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |