C17H18FN — CID 43633451
3-fluoro-N-[3-(4-methylphenyl)cyclobutyl]aniline (PubChem CID 43633451) has the molecular formula C17H18FN and a molecular weight of 255.34 g/mol. Its IUPAC name is 3-fluoro-N-[3-(4-methylphenyl)cyclobutyl]aniline.
| Compound Name | 3-fluoro-N-[3-(4-methylphenyl)cyclobutyl]aniline |
|---|---|
| PubChem CID | 43633451 |
| Molecular Formula | C17H18FN |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-fluoro-N-[3-(4-methylphenyl)cyclobutyl]aniline |
| SMILES | Cc1ccc(C2CC(Nc3cccc(F)c3)C2)cc1 |
| InChI | InChI=1S/C17H18FN/c1-12-5-7-13(8-6-12)14-9-17(10-14)19-16-4-2-3-15(18)11-16/h2-8,11,14,17,19H,9-10H2,1H3 |
| InChIKey | XBWLDKBHQMEROM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |