C18H24FN — CID 43634059
N-[2-(cyclohexen-1-yl)ethyl]-3-(4-fluorophenyl)cyclobutan-1-amine (PubChem CID 43634059) has the molecular formula C18H24FN and a molecular weight of 273.39 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-(4-fluorophenyl)cyclobutan-1-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-(4-fluorophenyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 43634059 |
| Molecular Formula | C18H24FN |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-(4-fluorophenyl)cyclobutan-1-amine |
| SMILES | Fc1ccc(C2CC(NCCC3=CCCCC3)C2)cc1 |
| InChI | InChI=1S/C18H24FN/c19-17-8-6-15(7-9-17)16-12-18(13-16)20-11-10-14-4-2-1-3-5-14/h4,6-9,16,18,20H,1-3,5,10-13H2 |
| InChIKey | KEHZNFQJLZZDCQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|