C19H22ClN — CID 43634161
3-(4-chlorophenyl)-N-(3-phenylpropyl)cyclobutan-1-amine (PubChem CID 43634161) has the molecular formula C19H22ClN and a molecular weight of 299.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(3-phenylpropyl)cyclobutan-1-amine.
| Compound Name | 3-(4-chlorophenyl)-N-(3-phenylpropyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 43634161 |
| Molecular Formula | C19H22ClN |
| Molecular Weight | 299.84 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(3-phenylpropyl)cyclobutan-1-amine |
| SMILES | Clc1ccc(C2CC(NCCCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C19H22ClN/c20-18-10-8-16(9-11-18)17-13-19(14-17)21-12-4-7-15-5-2-1-3-6-15/h1-3,5-6,8-11,17,19,21H,4,7,12-14H2 |
| InChIKey | YOPKRVKKJRZEIR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.84 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|