C17H16BrF2N — CID 43635256
2-bromo-4,6-difluoro-N-[3-(3-methylphenyl)cyclobutyl]aniline (PubChem CID 43635256) has the molecular formula C17H16BrF2N and a molecular weight of 352.22 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N-[3-(3-methylphenyl)cyclobutyl]aniline.
| Compound Name | 2-bromo-4,6-difluoro-N-[3-(3-methylphenyl)cyclobutyl]aniline |
|---|---|
| PubChem CID | 43635256 |
| Molecular Formula | C17H16BrF2N |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-bromo-4,6-difluoro-N-[3-(3-methylphenyl)cyclobutyl]aniline |
| SMILES | Cc1cccc(C2CC(Nc3c(F)cc(F)cc3Br)C2)c1 |
| InChI | InChI=1S/C17H16BrF2N/c1-10-3-2-4-11(5-10)12-6-14(7-12)21-17-15(18)8-13(19)9-16(17)20/h2-5,8-9,12,14,21H,6-7H2,1H3 |
| InChIKey | USROLELXAGQXRQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |