C15H20N2O4 — CID 43636447
3-(3,4-dimethoxyanilino)-1-propan-2-ylpyrrolidine-2,5-dione (PubChem CID 43636447) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-(3,4-dimethoxyanilino)-1-propan-2-ylpyrrolidine-2,5-dione.
| Compound Name | 3-(3,4-dimethoxyanilino)-1-propan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43636447 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 3-(3,4-dimethoxyanilino)-1-propan-2-ylpyrrolidine-2,5-dione |
| SMILES | COc1ccc(NC2CC(=O)N(C(C)C)C2=O)cc1OC |
| InChI | InChI=1S/C15H20N2O4/c1-9(2)17-14(18)8-11(15(17)19)16-10-5-6-12(20-3)13(7-10)21-4/h5-7,9,11,16H,8H2,1-4H3 |
| InChIKey | FDFQWTLRGAMBHB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|