About methyl 2-[(2,5-dioxopyrrolidin-3-yl)amino]acetate
methyl 2-[(2,5-dioxopyrrolidin-3-yl)amino]acetate (PubChem CID 43637687) has the molecular formula C7H10N2O4
and a molecular weight of 186.17 g/mol. Its IUPAC name is methyl 2-[(2,5-dioxopyrrolidin-3-yl)amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[(2,5-dioxopyrrolidin-3-yl)amino]acetate |
| PubChem CID | 43637687 |
| Molecular Formula | C7H10N2O4 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | methyl 2-[(2,5-dioxopyrrolidin-3-yl)amino]acetate |
| SMILES | COC(=O)CNC1CC(=O)NC1=O |
| InChI | InChI=1S/C7H10N2O4/c1-13-6(11)3-8-4-2-5(10)9-7(4)12/h4,8H,2-3H2,1H3,(H,9,10,12) |
| InChIKey | HLRMLOMCTUNDRT-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(2,5-dioxopyrrolidin-3-yl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2,5-dioxopyrrolidin-3-yl)amino]acetate?
The IUPAC name of methyl 2-[(2,5-dioxopyrrolidin-3-yl)amino]acetate (CID 43637687) is methyl 2-[(2,5-dioxopyrrolidin-3-yl)amino]acetate.
What is the SMILES notation for methyl 2-[(2,5-dioxopyrrolidin-3-yl)amino]acetate?
The canonical SMILES for methyl 2-[(2,5-dioxopyrrolidin-3-yl)amino]acetate is COC(=O)CNC1CC(=O)NC1=O.
What is the InChIKey of methyl 2-[(2,5-dioxopyrrolidin-3-yl)amino]acetate?
The InChIKey is HLRMLOMCTUNDRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4/c1-13-6(11)3-8-4-2-5(10)9-7(4)12/h4,8H,2-3H2,1H3,(H,9,10,12).
What are the key properties of methyl 2-[(2,5-dioxopyrrolidin-3-yl)amino]acetate?
methyl 2-[(2,5-dioxopyrrolidin-3-yl)amino]acetate has a molecular weight of 186.17 g/mol, XLogP of -1.84, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,5-dioxopyrrolidin-3-yl)amino]acetate is sourced from PubChem (CID 43637687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).