C13H11N3O2 — CID 43637754
3-(quinolin-8-ylamino)pyrrolidine-2,5-dione (PubChem CID 43637754) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 3-(quinolin-8-ylamino)pyrrolidine-2,5-dione.
| Compound Name | 3-(quinolin-8-ylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43637754 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-(quinolin-8-ylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(Nc2cccc3cccnc23)C(=O)N1 |
| InChI | InChI=1S/C13H11N3O2/c17-11-7-10(13(18)16-11)15-9-5-1-3-8-4-2-6-14-12(8)9/h1-6,10,15H,7H2,(H,16,17,18) |
| InChIKey | JOFSUTBRNCZGBL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|