C11H8F2N2O4 — CID 43637809
3-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyrrolidine-2,5-dione (PubChem CID 43637809) has the molecular formula C11H8F2N2O4 and a molecular weight of 270.19 g/mol. Its IUPAC name is 3-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyrrolidine-2,5-dione.
| Compound Name | 3-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43637809 |
| Molecular Formula | C11H8F2N2O4 |
| Molecular Weight | 270.19 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 3-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(Nc2ccc3c(c2)OC(F)(F)O3)C(=O)N1 |
| InChI | InChI=1S/C11H8F2N2O4/c12-11(13)18-7-2-1-5(3-8(7)19-11)14-6-4-9(16)15-10(6)17/h1-3,6,14H,4H2,(H,15,16,17) |
| InChIKey | OYOFINXMYMOXIR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.19 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|