C12H21N3O3 — CID 43638316
2-[(1-butan-2-yl-2,5-dioxopyrrolidin-3-yl)amino]-N-ethylacetamide (PubChem CID 43638316) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[(1-butan-2-yl-2,5-dioxopyrrolidin-3-yl)amino]-N-ethylacetamide.
| Compound Name | 2-[(1-butan-2-yl-2,5-dioxopyrrolidin-3-yl)amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 43638316 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-[(1-butan-2-yl-2,5-dioxopyrrolidin-3-yl)amino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNC1CC(=O)N(C(C)CC)C1=O |
| InChI | InChI=1S/C12H21N3O3/c1-4-8(3)15-11(17)6-9(12(15)18)14-7-10(16)13-5-2/h8-9,14H,4-7H2,1-3H3,(H,13,16) |
| InChIKey | CGFWBLOPYTXMQV-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|