C6H10N4O2S2 — CID 43638487
3-(1,1-dioxothiolan-3-yl)sulfanyl-1H-1,2,4-triazol-5-amine (PubChem CID 43638487) has the molecular formula C6H10N4O2S2 and a molecular weight of 234.31 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)sulfanyl-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)sulfanyl-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 43638487 |
| Molecular Formula | C6H10N4O2S2 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)sulfanyl-1H-1,2,4-triazol-5-amine |
| SMILES | Nc1nc(SC2CCS(=O)(=O)C2)n[nH]1 |
| InChI | InChI=1S/C6H10N4O2S2/c7-5-8-6(10-9-5)13-4-1-2-14(11,12)3-4/h4H,1-3H2,(H3,7,8,9,10) |
| InChIKey | WEBFKMHWXYVSQN-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |