C13H19N5O2S — CID 43638499
3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-1-cycloheptylpyrrolidine-2,5-dione (PubChem CID 43638499) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-1-cycloheptylpyrrolidine-2,5-dione.
| Compound Name | 3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-1-cycloheptylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43638499 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-1-cycloheptylpyrrolidine-2,5-dione |
| SMILES | Nc1nc(SC2CC(=O)N(C3CCCCCC3)C2=O)n[nH]1 |
| InChI | InChI=1S/C13H19N5O2S/c14-12-15-13(17-16-12)21-9-7-10(19)18(11(9)20)8-5-3-1-2-4-6-8/h8-9H,1-7H2,(H3,14,15,16,17) |
| InChIKey | KJYFYTLNZIAZKD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|