C15H24N2O4 — CID 43638689
2-[(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)amino]-3-methylbutanoic acid (PubChem CID 43638689) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-[(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)amino]-3-methylbutanoic acid.
| Compound Name | 2-[(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 43638689 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-[(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC1CC(=O)N(C2CCCCC2)C1=O)C(=O)O |
| InChI | InChI=1S/C15H24N2O4/c1-9(2)13(15(20)21)16-11-8-12(18)17(14(11)19)10-6-4-3-5-7-10/h9-11,13,16H,3-8H2,1-2H3,(H,20,21) |
| InChIKey | IOHRNFVSEVLLTN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|