C13H20N2O4 — CID 43638751
1-(2,5-dioxo-1-propylpyrrolidin-3-yl)piperidine-2-carboxylic acid (PubChem CID 43638751) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-(2,5-dioxo-1-propylpyrrolidin-3-yl)piperidine-2-carboxylic acid.
| Compound Name | 1-(2,5-dioxo-1-propylpyrrolidin-3-yl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43638751 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-(2,5-dioxo-1-propylpyrrolidin-3-yl)piperidine-2-carboxylic acid |
| SMILES | CCCN1C(=O)CC(N2CCCCC2C(=O)O)C1=O |
| InChI | InChI=1S/C13H20N2O4/c1-2-6-15-11(16)8-10(12(15)17)14-7-4-3-5-9(14)13(18)19/h9-10H,2-8H2,1H3,(H,18,19) |
| InChIKey | XGROWGBHFVZWAQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|