C11H13BrN2O3 — CID 43640386
2-[(4-bromo-1-cyclopropylpyrrole-2-carbonyl)amino]propanoic acid (PubChem CID 43640386) has the molecular formula C11H13BrN2O3 and a molecular weight of 301.14 g/mol. Its IUPAC name is 2-[(4-bromo-1-cyclopropylpyrrole-2-carbonyl)amino]propanoic acid.
| Compound Name | 2-[(4-bromo-1-cyclopropylpyrrole-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 43640386 |
| Molecular Formula | C11H13BrN2O3 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 2-[(4-bromo-1-cyclopropylpyrrole-2-carbonyl)amino]propanoic acid |
| SMILES | CC(NC(=O)c1cc(Br)cn1C1CC1)C(=O)O |
| InChI | InChI=1S/C11H13BrN2O3/c1-6(11(16)17)13-10(15)9-4-7(12)5-14(9)8-2-3-8/h4-6,8H,2-3H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | RMVVIXBHMHTIAX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |