C15H21BrN2O — CID 43640968
4-bromo-1-cyclopropyl-N-(4-methylcyclohexyl)pyrrole-2-carboxamide (PubChem CID 43640968) has the molecular formula C15H21BrN2O and a molecular weight of 325.25 g/mol. Its IUPAC name is 4-bromo-1-cyclopropyl-N-(4-methylcyclohexyl)pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-cyclopropyl-N-(4-methylcyclohexyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43640968 |
| Molecular Formula | C15H21BrN2O |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 4-bromo-1-cyclopropyl-N-(4-methylcyclohexyl)pyrrole-2-carboxamide |
| SMILES | CC1CCC(NC(=O)c2cc(Br)cn2C2CC2)CC1 |
| InChI | InChI=1S/C15H21BrN2O/c1-10-2-4-12(5-3-10)17-15(19)14-8-11(16)9-18(14)13-6-7-13/h8-10,12-13H,2-7H2,1H3,(H,17,19) |
| InChIKey | XWLCOFYFONKTHC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |