C14H15Cl2N3O — CID 43642744
4-amino-N-(2,4-dichlorophenyl)-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 43642744) has the molecular formula C14H15Cl2N3O and a molecular weight of 312.20 g/mol. Its IUPAC name is 4-amino-N-(2,4-dichlorophenyl)-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | 4-amino-N-(2,4-dichlorophenyl)-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43642744 |
| Molecular Formula | C14H15Cl2N3O |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 4-amino-N-(2,4-dichlorophenyl)-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CC(C)n1cc(N)cc1C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl2N3O/c1-8(2)19-7-10(17)6-13(19)14(20)18-12-4-3-9(15)5-11(12)16/h3-8H,17H2,1-2H3,(H,18,20) |
| InChIKey | DHGIOKHVPPPTID-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |