C14H25N3O — CID 43643260
4-amino-N,N-dibutyl-1-methylpyrrole-2-carboxamide (PubChem CID 43643260) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-amino-N,N-dibutyl-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-amino-N,N-dibutyl-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43643260 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 4-amino-N,N-dibutyl-1-methylpyrrole-2-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)c1cc(N)cn1C |
| InChI | InChI=1S/C14H25N3O/c1-4-6-8-17(9-7-5-2)14(18)13-10-12(15)11-16(13)3/h10-11H,4-9,15H2,1-3H3 |
| InChIKey | NZQJOUQFPJTSEI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |