C10H13N5O — CID 43643732
4-amino-N-(1-ethylpyrazol-4-yl)-1H-pyrrole-2-carboxamide (PubChem CID 43643732) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 4-amino-N-(1-ethylpyrazol-4-yl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-amino-N-(1-ethylpyrazol-4-yl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43643732 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 4-amino-N-(1-ethylpyrazol-4-yl)-1H-pyrrole-2-carboxamide |
| SMILES | CCn1cc(NC(=O)c2cc(N)c[nH]2)cn1 |
| InChI | InChI=1S/C10H13N5O/c1-2-15-6-8(5-13-15)14-10(16)9-3-7(11)4-12-9/h3-6,12H,2,11H2,1H3,(H,14,16) |
| InChIKey | DSPGOKVFXMLULU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |