C12H19N3O2 — CID 43644107
4-amino-N,1-dimethyl-N-(oxan-4-yl)pyrrole-2-carboxamide (PubChem CID 43644107) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-amino-N,1-dimethyl-N-(oxan-4-yl)pyrrole-2-carboxamide.
| Compound Name | 4-amino-N,1-dimethyl-N-(oxan-4-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43644107 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 4-amino-N,1-dimethyl-N-(oxan-4-yl)pyrrole-2-carboxamide |
| SMILES | CN(C(=O)c1cc(N)cn1C)C1CCOCC1 |
| InChI | InChI=1S/C12H19N3O2/c1-14-8-9(13)7-11(14)12(16)15(2)10-3-5-17-6-4-10/h7-8,10H,3-6,13H2,1-2H3 |
| InChIKey | DXVDIFUQWCHBOW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |