C13H14F3N3O — CID 43644812
N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(trifluoromethoxy)aniline (PubChem CID 43644812) has the molecular formula C13H14F3N3O and a molecular weight of 285.27 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(trifluoromethoxy)aniline.
| Compound Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 43644812 |
| Molecular Formula | C13H14F3N3O |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-(trifluoromethoxy)aniline |
| SMILES | Cc1n[nH]c(C)c1CNc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3N3O/c1-8-12(9(2)19-18-8)7-17-10-3-5-11(6-4-10)20-13(14,15)16/h3-6,17H,7H2,1-2H3,(H,18,19) |
| InChIKey | MXUFBQZUWRNMFV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|