C14H18N4S2 — CID 43645432
4-cyclopentyl-3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 43645432) has the molecular formula C14H18N4S2 and a molecular weight of 306.46 g/mol. Its IUPAC name is 4-cyclopentyl-3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-cyclopentyl-3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 43645432 |
| Molecular Formula | C14H18N4S2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-cyclopentyl-3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(N2CCc3sccc3C2)n1C1CCCC1 |
| InChI | InChI=1S/C14H18N4S2/c19-14-16-15-13(18(14)11-3-1-2-4-11)17-7-5-12-10(9-17)6-8-20-12/h6,8,11H,1-5,7,9H2,(H,16,19) |
| InChIKey | CHQBZXYFIADXRN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|