C5H5F3N4O2 — CID 43646857
6-(2,2,2-trifluoroethylamino)-2H-1,2,4-triazine-3,5-dione (PubChem CID 43646857) has the molecular formula C5H5F3N4O2 and a molecular weight of 210.11 g/mol. Its IUPAC name is 6-(2,2,2-trifluoroethylamino)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(2,2,2-trifluoroethylamino)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 43646857 |
| Molecular Formula | C5H5F3N4O2 |
| Molecular Weight | 210.11 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 6-(2,2,2-trifluoroethylamino)-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(NCC(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C5H5F3N4O2/c6-5(7,8)1-9-2-3(13)10-4(14)12-11-2/h1H2,(H,9,11)(H2,10,12,13,14) |
| InChIKey | BCQLYMDEEGSIFW-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.11 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |