C5H9N5O4S — CID 43646871
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]ethanesulfonamide (PubChem CID 43646871) has the molecular formula C5H9N5O4S and a molecular weight of 235.22 g/mol. Its IUPAC name is 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]ethanesulfonamide.
| Compound Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 43646871 |
| Molecular Formula | C5H9N5O4S |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H9N5O4S/c6-15(13,14)2-1-7-3-4(11)8-5(12)10-9-3/h1-2H2,(H,7,9)(H2,6,13,14)(H2,8,10,11,12) |
| InChIKey | JVRFGUFIVNAJFF-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 150.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |