C8H12N4O4S — CID 43646878
6-[(1,1-dioxothian-4-yl)amino]-2H-1,2,4-triazine-3,5-dione (PubChem CID 43646878) has the molecular formula C8H12N4O4S and a molecular weight of 260.27 g/mol. Its IUPAC name is 6-[(1,1-dioxothian-4-yl)amino]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[(1,1-dioxothian-4-yl)amino]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 43646878 |
| Molecular Formula | C8H12N4O4S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 6-[(1,1-dioxothian-4-yl)amino]-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(NC2CCS(=O)(=O)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C8H12N4O4S/c13-7-6(11-12-8(14)10-7)9-5-1-3-17(15,16)4-2-5/h5H,1-4H2,(H,9,11)(H2,10,12,13,14) |
| InChIKey | RXSBZOILGRIUHH-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |