C11H14N4O2 — CID 43647281
1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-3,5-dimethylpyrazole-4-carbaldehyde (PubChem CID 43647281) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-3,5-dimethylpyrazole-4-carbaldehyde.
| Compound Name | 1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-3,5-dimethylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 43647281 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-3,5-dimethylpyrazole-4-carbaldehyde |
| SMILES | CCc1noc(Cn2nc(C)c(C=O)c2C)n1 |
| InChI | InChI=1S/C11H14N4O2/c1-4-10-12-11(17-14-10)5-15-8(3)9(6-16)7(2)13-15/h6H,4-5H2,1-3H3 |
| InChIKey | FUVZNXIHNMVDOI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|