C11H18N2O — CID 43647303
[3,5-dimethyl-1-(3-methylbut-2-enyl)pyrazol-4-yl]methanol (PubChem CID 43647303) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is [3,5-dimethyl-1-(3-methylbut-2-enyl)pyrazol-4-yl]methanol.
| Compound Name | [3,5-dimethyl-1-(3-methylbut-2-enyl)pyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 43647303 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | [3,5-dimethyl-1-(3-methylbut-2-enyl)pyrazol-4-yl]methanol |
| SMILES | CC(C)=CCn1nc(C)c(CO)c1C |
| InChI | InChI=1S/C11H18N2O/c1-8(2)5-6-13-10(4)11(7-14)9(3)12-13/h5,14H,6-7H2,1-4H3 |
| InChIKey | JQOJMEHOEQXQOU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|