About 2-[4-(hydroxymethyl)-3,5-dimethylpyrazol-1-yl]-1-pyrrolidin-1-ylethanone
2-[4-(hydroxymethyl)-3,5-dimethylpyrazol-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 43647343) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-[4-(hydroxymethyl)-3,5-dimethylpyrazol-1-yl]-1-pyrrolidin-1-ylethanone.
Molecular Properties
| Compound Name | 2-[4-(hydroxymethyl)-3,5-dimethylpyrazol-1-yl]-1-pyrrolidin-1-ylethanone |
| PubChem CID | 43647343 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-[4-(hydroxymethyl)-3,5-dimethylpyrazol-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | Cc1nn(CC(=O)N2CCCC2)c(C)c1CO |
| InChI | InChI=1S/C12H19N3O2/c1-9-11(8-16)10(2)15(13-9)7-12(17)14-5-3-4-6-14/h16H,3-8H2,1-2H3 |
| InChIKey | QXGMWAHCIVMYHR-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(hydroxymethyl)-3,5-dimethylpyrazol-1-yl]-1-pyrrolidin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(hydroxymethyl)-3,5-dimethylpyrazol-1-yl]-1-pyrrolidin-1-ylethanone?
The IUPAC name of 2-[4-(hydroxymethyl)-3,5-dimethylpyrazol-1-yl]-1-pyrrolidin-1-ylethanone (CID 43647343) is 2-[4-(hydroxymethyl)-3,5-dimethylpyrazol-1-yl]-1-pyrrolidin-1-ylethanone.
What is the SMILES notation for 2-[4-(hydroxymethyl)-3,5-dimethylpyrazol-1-yl]-1-pyrrolidin-1-ylethanone?
The canonical SMILES for 2-[4-(hydroxymethyl)-3,5-dimethylpyrazol-1-yl]-1-pyrrolidin-1-ylethanone is Cc1nn(CC(=O)N2CCCC2)c(C)c1CO.
What is the InChIKey of 2-[4-(hydroxymethyl)-3,5-dimethylpyrazol-1-yl]-1-pyrrolidin-1-ylethanone?
The InChIKey is QXGMWAHCIVMYHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c1-9-11(8-16)10(2)15(13-9)7-12(17)14-5-3-4-6-14/h16H,3-8H2,1-2H3.
What are the key properties of 2-[4-(hydroxymethyl)-3,5-dimethylpyrazol-1-yl]-1-pyrrolidin-1-ylethanone?
2-[4-(hydroxymethyl)-3,5-dimethylpyrazol-1-yl]-1-pyrrolidin-1-ylethanone has a molecular weight of 237.30 g/mol, XLogP of 0.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(hydroxymethyl)-3,5-dimethylpyrazol-1-yl]-1-pyrrolidin-1-ylethanone is sourced from PubChem (CID 43647343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).