C17H22N4 — CID 43647905
3-[[3,5-dimethyl-4-(propylaminomethyl)pyrazol-1-yl]methyl]benzonitrile (PubChem CID 43647905) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 3-[[3,5-dimethyl-4-(propylaminomethyl)pyrazol-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[3,5-dimethyl-4-(propylaminomethyl)pyrazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 43647905 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 3-[[3,5-dimethyl-4-(propylaminomethyl)pyrazol-1-yl]methyl]benzonitrile |
| SMILES | CCCNCc1c(C)nn(Cc2cccc(C#N)c2)c1C |
| InChI | InChI=1S/C17H22N4/c1-4-8-19-11-17-13(2)20-21(14(17)3)12-16-7-5-6-15(9-16)10-18/h5-7,9,19H,4,8,11-12H2,1-3H3 |
| InChIKey | QRMPKKBWWQPQDA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|