C16H29N3 — CID 43648067
N-[(1-heptyl-3,5-dimethylpyrazol-4-yl)methyl]cyclopropanamine (PubChem CID 43648067) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is N-[(1-heptyl-3,5-dimethylpyrazol-4-yl)methyl]cyclopropanamine.
| Compound Name | N-[(1-heptyl-3,5-dimethylpyrazol-4-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 43648067 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | N-[(1-heptyl-3,5-dimethylpyrazol-4-yl)methyl]cyclopropanamine |
| SMILES | CCCCCCCn1nc(C)c(CNC2CC2)c1C |
| InChI | InChI=1S/C16H29N3/c1-4-5-6-7-8-11-19-14(3)16(13(2)18-19)12-17-15-9-10-15/h15,17H,4-12H2,1-3H3 |
| InChIKey | NSQPDHDCOOYYIQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|