About 5-amino-3-chloro-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide
5-amino-3-chloro-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide (PubChem CID 43648503) has the molecular formula C11H14ClFN2O4S2
and a molecular weight of 356.83 g/mol. Its IUPAC name is 5-amino-3-chloro-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 5-amino-3-chloro-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide |
| PubChem CID | 43648503 |
| Molecular Formula | C11H14ClFN2O4S2 |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 5-amino-3-chloro-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCS(=O)(=O)C1)S(=O)(=O)c1cc(N)cc(Cl)c1F |
| InChI | InChI=1S/C11H14ClFN2O4S2/c1-15(8-2-3-20(16,17)6-8)21(18,19)10-5-7(14)4-9(12)11(10)13/h4-5,8H,2-3,6,14H2,1H3 |
| InChIKey | FEGAZJNBPNNHRD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-3-chloro-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-chloro-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide?
The IUPAC name of 5-amino-3-chloro-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide (CID 43648503) is 5-amino-3-chloro-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide.
What is the SMILES notation for 5-amino-3-chloro-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide?
The canonical SMILES for 5-amino-3-chloro-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide is CN(C1CCS(=O)(=O)C1)S(=O)(=O)c1cc(N)cc(Cl)c1F.
What is the InChIKey of 5-amino-3-chloro-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide?
The InChIKey is FEGAZJNBPNNHRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClFN2O4S2/c1-15(8-2-3-20(16,17)6-8)21(18,19)10-5-7(14)4-9(12)11(10)13/h4-5,8H,2-3,6,14H2,1H3.
What are the key properties of 5-amino-3-chloro-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide?
5-amino-3-chloro-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide has a molecular weight of 356.83 g/mol, XLogP of 0.87, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-chloro-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide is sourced from PubChem (CID 43648503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).