About N-(1,1-dioxothiolan-3-yl)-N-methylsulfamoyl chloride
N-(1,1-dioxothiolan-3-yl)-N-methylsulfamoyl chloride (PubChem CID 43648696) has the molecular formula C5H10ClNO4S2
and a molecular weight of 247.72 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methylsulfamoyl chloride.
Molecular Properties
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methylsulfamoyl chloride |
| PubChem CID | 43648696 |
| Molecular Formula | C5H10ClNO4S2 |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 246.97 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methylsulfamoyl chloride |
| SMILES | CN(C1CCS(=O)(=O)C1)S(=O)(=O)Cl |
| InChI | InChI=1S/C5H10ClNO4S2/c1-7(13(6,10)11)5-2-3-12(8,9)4-5/h5H,2-4H2,1H3 |
| InChIKey | FHGYCADQYQRNIN-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,1-dioxothiolan-3-yl)-N-methylsulfamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dioxothiolan-3-yl)-N-methylsulfamoyl chloride?
The IUPAC name of N-(1,1-dioxothiolan-3-yl)-N-methylsulfamoyl chloride (CID 43648696) is N-(1,1-dioxothiolan-3-yl)-N-methylsulfamoyl chloride.
What is the SMILES notation for N-(1,1-dioxothiolan-3-yl)-N-methylsulfamoyl chloride?
The canonical SMILES for N-(1,1-dioxothiolan-3-yl)-N-methylsulfamoyl chloride is CN(C1CCS(=O)(=O)C1)S(=O)(=O)Cl.
What is the InChIKey of N-(1,1-dioxothiolan-3-yl)-N-methylsulfamoyl chloride?
The InChIKey is FHGYCADQYQRNIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10ClNO4S2/c1-7(13(6,10)11)5-2-3-12(8,9)4-5/h5H,2-4H2,1H3.
What are the key properties of N-(1,1-dioxothiolan-3-yl)-N-methylsulfamoyl chloride?
N-(1,1-dioxothiolan-3-yl)-N-methylsulfamoyl chloride has a molecular weight of 247.72 g/mol, XLogP of -0.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dioxothiolan-3-yl)-N-methylsulfamoyl chloride is sourced from PubChem (CID 43648696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).