About 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3-fluorobenzenecarboximidamide
4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3-fluorobenzenecarboximidamide (PubChem CID 43648790) has the molecular formula C13H18FN3O2S
and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3-fluorobenzenecarboximidamide.
Molecular Properties
| Compound Name | 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3-fluorobenzenecarboximidamide |
| PubChem CID | 43648790 |
| Molecular Formula | C13H18FN3O2S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN(C)C2CCS(=O)(=O)C2)c(F)c1 |
| InChI | InChI=1S/C13H18FN3O2S/c1-17(11-4-5-20(18,19)8-11)7-10-3-2-9(13(15)16)6-12(10)14/h2-3,6,11H,4-5,7-8H2,1H3,(H3,15,16) |
| InChIKey | DZRNAYFGAZLDMR-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3-fluorobenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3-fluorobenzenecarboximidamide?
The IUPAC name of 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3-fluorobenzenecarboximidamide (CID 43648790) is 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3-fluorobenzenecarboximidamide.
What is the SMILES notation for 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3-fluorobenzenecarboximidamide?
The canonical SMILES for 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3-fluorobenzenecarboximidamide is [H]/N=C(\N)c1ccc(CN(C)C2CCS(=O)(=O)C2)c(F)c1.
What is the InChIKey of 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3-fluorobenzenecarboximidamide?
The InChIKey is DZRNAYFGAZLDMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FN3O2S/c1-17(11-4-5-20(18,19)8-11)7-10-3-2-9(13(15)16)6-12(10)14/h2-3,6,11H,4-5,7-8H2,1H3,(H3,15,16).
What are the key properties of 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3-fluorobenzenecarboximidamide?
4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3-fluorobenzenecarboximidamide has a molecular weight of 299.37 g/mol, XLogP of 0.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3-fluorobenzenecarboximidamide is sourced from PubChem (CID 43648790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).