C13H22N2O3S — CID 43649164
2-(1,1-dioxothiolan-3-yl)-1-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)ethanone (PubChem CID 43649164) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-1-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)ethanone.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-1-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)ethanone |
|---|---|
| PubChem CID | 43649164 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-1-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)ethanone |
| SMILES | CC1CC2CNCC2N1C(=O)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H22N2O3S/c1-9-4-11-6-14-7-12(11)15(9)13(16)5-10-2-3-19(17,18)8-10/h9-12,14H,2-8H2,1H3 |
| InChIKey | CKQCMVVKWHMXFY-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |