About 3-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]propan-1-amine
3-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]propan-1-amine (PubChem CID 43650814) has the molecular formula C12H13F2N3
and a molecular weight of 237.25 g/mol. Its IUPAC name is 3-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]propan-1-amine |
| PubChem CID | 43650814 |
| Molecular Formula | C12H13F2N3 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 3-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]propan-1-amine |
| SMILES | NCCCc1ncc(-c2ccc(F)c(F)c2)[nH]1 |
| InChI | InChI=1S/C12H13F2N3/c13-9-4-3-8(6-10(9)14)11-7-16-12(17-11)2-1-5-15/h3-4,6-7H,1-2,5,15H2,(H,16,17) |
| InChIKey | QMHXHELUYJKATE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]propan-1-amine?
The IUPAC name of 3-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]propan-1-amine (CID 43650814) is 3-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]propan-1-amine.
What is the SMILES notation for 3-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]propan-1-amine?
The canonical SMILES for 3-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]propan-1-amine is NCCCc1ncc(-c2ccc(F)c(F)c2)[nH]1.
What is the InChIKey of 3-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]propan-1-amine?
The InChIKey is QMHXHELUYJKATE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2N3/c13-9-4-3-8(6-10(9)14)11-7-16-12(17-11)2-1-5-15/h3-4,6-7H,1-2,5,15H2,(H,16,17).
What are the key properties of 3-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]propan-1-amine?
3-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]propan-1-amine has a molecular weight of 237.25 g/mol, XLogP of 2.25, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]propan-1-amine is sourced from PubChem (CID 43650814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).