About 5-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]pentan-1-amine
5-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]pentan-1-amine (PubChem CID 43651179) has the molecular formula C16H23N3
and a molecular weight of 257.38 g/mol. Its IUPAC name is 5-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]pentan-1-amine.
Molecular Properties
| Compound Name | 5-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]pentan-1-amine |
| PubChem CID | 43651179 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 5-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]pentan-1-amine |
| SMILES | Cc1ccc(-c2cnc(CCCCCN)[nH]2)c(C)c1 |
| InChI | InChI=1S/C16H23N3/c1-12-7-8-14(13(2)10-12)15-11-18-16(19-15)6-4-3-5-9-17/h7-8,10-11H,3-6,9,17H2,1-2H3,(H,18,19) |
| InChIKey | PWMHDGHOFVXNMP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]pentan-1-amine?
The IUPAC name of 5-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]pentan-1-amine (CID 43651179) is 5-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]pentan-1-amine.
What is the SMILES notation for 5-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]pentan-1-amine?
The canonical SMILES for 5-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]pentan-1-amine is Cc1ccc(-c2cnc(CCCCCN)[nH]2)c(C)c1.
What is the InChIKey of 5-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]pentan-1-amine?
The InChIKey is PWMHDGHOFVXNMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3/c1-12-7-8-14(13(2)10-12)15-11-18-16(19-15)6-4-3-5-9-17/h7-8,10-11H,3-6,9,17H2,1-2H3,(H,18,19).
What are the key properties of 5-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]pentan-1-amine?
5-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]pentan-1-amine has a molecular weight of 257.38 g/mol, XLogP of 3.37, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]pentan-1-amine is sourced from PubChem (CID 43651179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).