C16H23N3O2 — CID 43651303
1-[5-(3,4-dimethoxyphenyl)-1H-imidazol-2-yl]-3-methylbutan-1-amine (PubChem CID 43651303) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-[5-(3,4-dimethoxyphenyl)-1H-imidazol-2-yl]-3-methylbutan-1-amine.
| Compound Name | 1-[5-(3,4-dimethoxyphenyl)-1H-imidazol-2-yl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 43651303 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-[5-(3,4-dimethoxyphenyl)-1H-imidazol-2-yl]-3-methylbutan-1-amine |
| SMILES | COc1ccc(-c2cnc(C(N)CC(C)C)[nH]2)cc1OC |
| InChI | InChI=1S/C16H23N3O2/c1-10(2)7-12(17)16-18-9-13(19-16)11-5-6-14(20-3)15(8-11)21-4/h5-6,8-10,12H,7,17H2,1-4H3,(H,18,19) |
| InChIKey | QELTXFNXBXEPKA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |