C12H17N3O2S2 — CID 43651681
3-methylsulfonyl-1-[5-(5-methylthiophen-2-yl)-1H-imidazol-2-yl]propan-1-amine (PubChem CID 43651681) has the molecular formula C12H17N3O2S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 3-methylsulfonyl-1-[5-(5-methylthiophen-2-yl)-1H-imidazol-2-yl]propan-1-amine.
| Compound Name | 3-methylsulfonyl-1-[5-(5-methylthiophen-2-yl)-1H-imidazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 43651681 |
| Molecular Formula | C12H17N3O2S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 3-methylsulfonyl-1-[5-(5-methylthiophen-2-yl)-1H-imidazol-2-yl]propan-1-amine |
| SMILES | Cc1ccc(-c2cnc(C(N)CCS(C)(=O)=O)[nH]2)s1 |
| InChI | InChI=1S/C12H17N3O2S2/c1-8-3-4-11(18-8)10-7-14-12(15-10)9(13)5-6-19(2,16)17/h3-4,7,9H,5-6,13H2,1-2H3,(H,14,15) |
| InChIKey | BAGTUIUSFQMTNB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |