1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid

C11H9Cl2N3O2 — CID 43652653

IUPAC1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid
SMILESCCc1nc(C(=O)O)nn1-c1c(Cl)cccc1Cl
InChIInChI=1S/C11H9Cl2N3O2/c1-2-8-14-10(11(17)18)15-16(8)9-6(12)4-3-5-7(9)13/h3-5H,2H2,1H3,(H,17,18)
InChIKeyLDWSTIABOAHMJC-UHFFFAOYSA-N
MW286.12 g/mol
LogP2.83
Rot. Bonds3

About 1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid

1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid (PubChem CID 43652653) has the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid.

Molecular Properties

Compound Name1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid
PubChem CID43652653
Molecular FormulaC11H9Cl2N3O2
Molecular Weight286.12 g/mol
Exact Mass285.01
IUPAC Name1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid
SMILESCCc1nc(C(=O)O)nn1-c1c(Cl)cccc1Cl
InChIInChI=1S/C11H9Cl2N3O2/c1-2-8-14-10(11(17)18)15-16(8)9-6(12)4-3-5-7(9)13/h3-5H,2H2,1H3,(H,17,18)
InChIKeyLDWSTIABOAHMJC-UHFFFAOYSA-N
XLogP2.83
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.12
LogP ≤ 52.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid?
The IUPAC name of 1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid (CID 43652653) is 1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid.
What is the SMILES notation for 1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid?
The canonical SMILES for 1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid is CCc1nc(C(=O)O)nn1-c1c(Cl)cccc1Cl.
What is the InChIKey of 1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid?
The InChIKey is LDWSTIABOAHMJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2N3O2/c1-2-8-14-10(11(17)18)15-16(8)9-6(12)4-3-5-7(9)13/h3-5H,2H2,1H3,(H,17,18).
What are the key properties of 1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid?
1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid has a molecular weight of 286.12 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dichlorophenyl)-5-ethyl-1,2,4-triazole-3-carboxylic acid is sourced from PubChem (CID 43652653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).