C12H21NO2 — CID 43652772
3,3-dimethyl-N-(4-oxocyclohexyl)butanamide (PubChem CID 43652772) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 3,3-dimethyl-N-(4-oxocyclohexyl)butanamide.
| Compound Name | 3,3-dimethyl-N-(4-oxocyclohexyl)butanamide |
|---|---|
| PubChem CID | 43652772 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 3,3-dimethyl-N-(4-oxocyclohexyl)butanamide |
| SMILES | CC(C)(C)CC(=O)NC1CCC(=O)CC1 |
| InChI | InChI=1S/C12H21NO2/c1-12(2,3)8-11(15)13-9-4-6-10(14)7-5-9/h9H,4-8H2,1-3H3,(H,13,15) |
| InChIKey | BXCSIVLKIILJSH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |