C13H13Cl2NO2 — CID 43652866
3,4-dichloro-N-(4-oxocyclohexyl)benzamide (PubChem CID 43652866) has the molecular formula C13H13Cl2NO2 and a molecular weight of 286.16 g/mol. Its IUPAC name is 3,4-dichloro-N-(4-oxocyclohexyl)benzamide.
| Compound Name | 3,4-dichloro-N-(4-oxocyclohexyl)benzamide |
|---|---|
| PubChem CID | 43652866 |
| Molecular Formula | C13H13Cl2NO2 |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 3,4-dichloro-N-(4-oxocyclohexyl)benzamide |
| SMILES | O=C1CCC(NC(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H13Cl2NO2/c14-11-6-1-8(7-12(11)15)13(18)16-9-2-4-10(17)5-3-9/h1,6-7,9H,2-5H2,(H,16,18) |
| InChIKey | VDIPJVUGDNGDKU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |