C14H21ClN2O3S — CID 43653866
N-butan-2-yl-2-(3-chloropropylsulfonylamino)benzamide (PubChem CID 43653866) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is N-butan-2-yl-2-(3-chloropropylsulfonylamino)benzamide.
| Compound Name | N-butan-2-yl-2-(3-chloropropylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 43653866 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-butan-2-yl-2-(3-chloropropylsulfonylamino)benzamide |
| SMILES | CCC(C)NC(=O)c1ccccc1NS(=O)(=O)CCCCl |
| InChI | InChI=1S/C14H21ClN2O3S/c1-3-11(2)16-14(18)12-7-4-5-8-13(12)17-21(19,20)10-6-9-15/h4-5,7-8,11,17H,3,6,9-10H2,1-2H3,(H,16,18) |
| InChIKey | WEFOQCKDAZPKLH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|