About 3-chloro-N,N-bis(prop-2-enyl)propane-1-sulfonamide
3-chloro-N,N-bis(prop-2-enyl)propane-1-sulfonamide (PubChem CID 43653918) has the molecular formula C9H16ClNO2S
and a molecular weight of 237.75 g/mol. Its IUPAC name is 3-chloro-N,N-bis(prop-2-enyl)propane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-chloro-N,N-bis(prop-2-enyl)propane-1-sulfonamide |
| PubChem CID | 43653918 |
| Molecular Formula | C9H16ClNO2S |
| Molecular Weight | 237.75 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 3-chloro-N,N-bis(prop-2-enyl)propane-1-sulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)CCCCl |
| InChI | InChI=1S/C9H16ClNO2S/c1-3-7-11(8-4-2)14(12,13)9-5-6-10/h3-4H,1-2,5-9H2 |
| InChIKey | NQVRRILOWDIAOQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.75 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N,N-bis(prop-2-enyl)propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N,N-bis(prop-2-enyl)propane-1-sulfonamide?
The IUPAC name of 3-chloro-N,N-bis(prop-2-enyl)propane-1-sulfonamide (CID 43653918) is 3-chloro-N,N-bis(prop-2-enyl)propane-1-sulfonamide.
What is the SMILES notation for 3-chloro-N,N-bis(prop-2-enyl)propane-1-sulfonamide?
The canonical SMILES for 3-chloro-N,N-bis(prop-2-enyl)propane-1-sulfonamide is C=CCN(CC=C)S(=O)(=O)CCCCl.
What is the InChIKey of 3-chloro-N,N-bis(prop-2-enyl)propane-1-sulfonamide?
The InChIKey is NQVRRILOWDIAOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClNO2S/c1-3-7-11(8-4-2)14(12,13)9-5-6-10/h3-4H,1-2,5-9H2.
What are the key properties of 3-chloro-N,N-bis(prop-2-enyl)propane-1-sulfonamide?
3-chloro-N,N-bis(prop-2-enyl)propane-1-sulfonamide has a molecular weight of 237.75 g/mol, XLogP of 1.62, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N,N-bis(prop-2-enyl)propane-1-sulfonamide is sourced from PubChem (CID 43653918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).