About 3-chloro-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide
3-chloro-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide (PubChem CID 43654160) has the molecular formula C5H9ClF3NO2S
and a molecular weight of 239.65 g/mol. Its IUPAC name is 3-chloro-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-chloro-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide |
| PubChem CID | 43654160 |
| Molecular Formula | C5H9ClF3NO2S |
| Molecular Weight | 239.65 g/mol |
| Exact Mass | 239.00 |
| IUPAC Name | 3-chloro-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)NCC(F)(F)F |
| InChI | InChI=1S/C5H9ClF3NO2S/c6-2-1-3-13(11,12)10-4-5(7,8)9/h10H,1-4H2 |
| InChIKey | KBKFZFMXQSBHKO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.65 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide?
The IUPAC name of 3-chloro-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide (CID 43654160) is 3-chloro-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide.
What is the SMILES notation for 3-chloro-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide?
The canonical SMILES for 3-chloro-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide is O=S(=O)(CCCCl)NCC(F)(F)F.
What is the InChIKey of 3-chloro-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide?
The InChIKey is KBKFZFMXQSBHKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClF3NO2S/c6-2-1-3-13(11,12)10-4-5(7,8)9/h10H,1-4H2.
What are the key properties of 3-chloro-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide?
3-chloro-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide has a molecular weight of 239.65 g/mol, XLogP of 1.10, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide is sourced from PubChem (CID 43654160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).