C10H21ClN2O2S — CID 43654453
3-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]propane-1-sulfonamide (PubChem CID 43654453) has the molecular formula C10H21ClN2O2S and a molecular weight of 268.81 g/mol. Its IUPAC name is 3-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 43654453 |
| Molecular Formula | C10H21ClN2O2S |
| Molecular Weight | 268.81 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]propane-1-sulfonamide |
| SMILES | CCN1CCCC1CNS(=O)(=O)CCCCl |
| InChI | InChI=1S/C10H21ClN2O2S/c1-2-13-7-3-5-10(13)9-12-16(14,15)8-4-6-11/h10,12H,2-9H2,1H3 |
| InChIKey | UIUONGKKYYABMG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.81 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|