About 3-chloro-N-(2,5-dimethylpyrazol-3-yl)propane-1-sulfonamide
3-chloro-N-(2,5-dimethylpyrazol-3-yl)propane-1-sulfonamide (PubChem CID 43654462) has the molecular formula C8H14ClN3O2S
and a molecular weight of 251.74 g/mol. Its IUPAC name is 3-chloro-N-(2,5-dimethylpyrazol-3-yl)propane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-chloro-N-(2,5-dimethylpyrazol-3-yl)propane-1-sulfonamide |
| PubChem CID | 43654462 |
| Molecular Formula | C8H14ClN3O2S |
| Molecular Weight | 251.74 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 3-chloro-N-(2,5-dimethylpyrazol-3-yl)propane-1-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)CCCCl)n(C)n1 |
| InChI | InChI=1S/C8H14ClN3O2S/c1-7-6-8(12(2)10-7)11-15(13,14)5-3-4-9/h6,11H,3-5H2,1-2H3 |
| InChIKey | KCHHNVIIONQAJF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.74 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-(2,5-dimethylpyrazol-3-yl)propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(2,5-dimethylpyrazol-3-yl)propane-1-sulfonamide?
The IUPAC name of 3-chloro-N-(2,5-dimethylpyrazol-3-yl)propane-1-sulfonamide (CID 43654462) is 3-chloro-N-(2,5-dimethylpyrazol-3-yl)propane-1-sulfonamide.
What is the SMILES notation for 3-chloro-N-(2,5-dimethylpyrazol-3-yl)propane-1-sulfonamide?
The canonical SMILES for 3-chloro-N-(2,5-dimethylpyrazol-3-yl)propane-1-sulfonamide is Cc1cc(NS(=O)(=O)CCCCl)n(C)n1.
What is the InChIKey of 3-chloro-N-(2,5-dimethylpyrazol-3-yl)propane-1-sulfonamide?
The InChIKey is KCHHNVIIONQAJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14ClN3O2S/c1-7-6-8(12(2)10-7)11-15(13,14)5-3-4-9/h6,11H,3-5H2,1-2H3.
What are the key properties of 3-chloro-N-(2,5-dimethylpyrazol-3-yl)propane-1-sulfonamide?
3-chloro-N-(2,5-dimethylpyrazol-3-yl)propane-1-sulfonamide has a molecular weight of 251.74 g/mol, XLogP of 1.10, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(2,5-dimethylpyrazol-3-yl)propane-1-sulfonamide is sourced from PubChem (CID 43654462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).