About [3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine
[3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine (PubChem CID 43657630) has the molecular formula C9H9FN4S
and a molecular weight of 224.26 g/mol. Its IUPAC name is [3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine.
Molecular Properties
| Compound Name | [3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine |
| PubChem CID | 43657630 |
| Molecular Formula | C9H9FN4S |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | [3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine |
| SMILES | NCc1ccc(Sc2ncn[nH]2)c(F)c1 |
| InChI | InChI=1S/C9H9FN4S/c10-7-3-6(4-11)1-2-8(7)15-9-12-5-13-14-9/h1-3,5H,4,11H2,(H,12,13,14) |
| InChIKey | FMVYDYUMNUOBOA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine?
The IUPAC name of [3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine (CID 43657630) is [3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine.
What is the SMILES notation for [3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine?
The canonical SMILES for [3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine is NCc1ccc(Sc2ncn[nH]2)c(F)c1.
What is the InChIKey of [3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine?
The InChIKey is FMVYDYUMNUOBOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN4S/c10-7-3-6(4-11)1-2-8(7)15-9-12-5-13-14-9/h1-3,5H,4,11H2,(H,12,13,14).
What are the key properties of [3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine?
[3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine has a molecular weight of 224.26 g/mol, XLogP of 1.55, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methanamine is sourced from PubChem (CID 43657630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).