C14H17FN4S — CID 43657644
[3-fluoro-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)phenyl]methanamine (PubChem CID 43657644) has the molecular formula C14H17FN4S and a molecular weight of 292.38 g/mol. Its IUPAC name is [3-fluoro-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)phenyl]methanamine.
| Compound Name | [3-fluoro-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)phenyl]methanamine |
|---|---|
| PubChem CID | 43657644 |
| Molecular Formula | C14H17FN4S |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | [3-fluoro-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)phenyl]methanamine |
| SMILES | NCc1ccc(Sc2nnc3n2CCCCC3)c(F)c1 |
| InChI | InChI=1S/C14H17FN4S/c15-11-8-10(9-16)5-6-12(11)20-14-18-17-13-4-2-1-3-7-19(13)14/h5-6,8H,1-4,7,9,16H2 |
| InChIKey | ZZNXGUDHWWDSPM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |